0LZ: N-(4-chloro-3-fluorophenyl)-N'-[(1S)-1,2,3,4-tetrahydroisoquinolin-1-ylmethyl]ethanediamide
0LZ is a Ligand Of Interest in 4DVT designated by the RCSB
| Best-fitted instance in this entry | |
| Other instances in this entry |
| Identifier | Ranking for goodness of fit | Ranking for geometry | Real space R factor | Real space correlation coefficient | RMSZ-bond-length | RMSZ-bond-angle | Outliers of bond length | Outliers of bond angle | Atomic clashes | Stereochemical errors | Model completeness | Average occupancy |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| 4DVT_0LZ_A_512 | 42% | 20% | 0.147 | 0.865 | 1.49 | 1.76 | 6 | 6 | 2 | 0 | 100% | 1 |
| 4DVT_0LZ_B_512 | 13% | 20% | 0.188 | 0.737 | 1.51 | 1.77 | 6 | 5 | 1 | 0 | 100% | 1 |
