YDJ
5-(3-fluorophenyl)-N-[(3S)-3-piperidyl]-3-ureido-thiophene-2-carboxamide
| Created: | 2011-03-22 |
| Last modified: | 2013-03-15 |
Find Related PDB Entry |
|---|
Find related ligands:Help |
|---|
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 44 |
| Chiral Atom Count | 1 |
| Bond Count | 46 |
| Aromatic Bond Count | 12 |
Chemical Component Summary | |
|---|---|
| Name | 5-(3-fluorophenyl)-N-[(3S)-3-piperidyl]-3-ureido-thiophene-2-carboxamide |
| Systematic Name (OpenEye OEToolkits) | 3-(aminocarbonylamino)-5-(3-fluorophenyl)-N-[(3S)-piperidin-3-yl]thiophene-2-carboxamide |
| Formula | C17 H19 F N4 O2 S |
| Molecular Weight | 362.422 |
| Type | NON-POLYMER |
Chemical Descriptors | |||
|---|---|---|---|
| Type | Program | Version | Descriptor |
| SMILES | ACDLabs | 12.01 | O=C(c1sc(cc1NC(=O)N)c2cccc(F)c2)NC3CCCNC3 |
| SMILES | CACTVS | 3.370 | NC(=O)Nc1cc(sc1C(=O)N[CH]2CCCNC2)c3cccc(F)c3 |
| SMILES | OpenEye OEToolkits | 1.7.0 | c1cc(cc(c1)F)c2cc(c(s2)C(=O)NC3CCCNC3)NC(=O)N |
| Canonical SMILES | CACTVS | 3.370 | NC(=O)Nc1cc(sc1C(=O)N[C@H]2CCCNC2)c3cccc(F)c3 |
| Canonical SMILES | OpenEye OEToolkits | 1.7.0 | c1cc(cc(c1)F)c2cc(c(s2)C(=O)N[C@H]3CCCNC3)NC(=O)N |
| InChI | InChI | 1.03 | InChI=1S/C17H19FN4O2S/c18-11-4-1-3-10(7-11)14-8-13(22-17(19)24)15(25-14)16(23)21-12-5-2-6-20-9-12/h1,3-4,7-8,12,20H,2,5-6,9H2,(H,21,23)(H3,19,22,24)/t12-/m0/s1 |
| InChIKey | InChI | 1.03 | IAYGCINLNONXHY-LBPRGKRZSA-N |
Drug Info: DrugBank
DrugBank data are sourced from datasets licensed under a Creative Common's Attribution-NonCommercial 4.0 International License
| DrugBank ID | DB12242 |
|---|---|
| Name | AZD-7762 |
| Description | AZD7762 has been investigated for the treatment of Cancer, Solid Tumors, and Advanced Solid Malignancies. |
| Synonyms | AZD-7762 |
| Categories |
|
| CAS number | 860352-01-8 |
Related Resource References
| Resource Name | Reference |
|---|---|
| Pharos | CHEMBL2041933 |
| PubChem | 11152667 |
| ChEMBL | CHEMBL2041933 |
| ChEBI | CHEBI:131156 |
