XNO
xanomeline
| Created: | 2023-02-03 |
| Last modified: | 2023-09-13 |
Find Related PDB Entry |
|---|
Find related ligands:Help |
|---|
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 42 |
| Chiral Atom Count | 0 |
| Bond Count | 43 |
| Aromatic Bond Count | 5 |
Chemical Component Summary | |
|---|---|
| Name | xanomeline |
| Synonyms | (5M)-5-[4-(hexyloxy)-1,2,5-thiadiazol-3-yl]-1-methyl-1,2,3,6-tetrahydropyridine |
| Systematic Name (OpenEye OEToolkits) | 3-hexoxy-4-(1-methyl-3,6-dihydro-2~{H}-pyridin-5-yl)-1,2,5-thiadiazole |
| Formula | C14 H23 N3 O S |
| Molecular Weight | 281.417 |
| Type | NON-POLYMER |
Chemical Descriptors | |||
|---|---|---|---|
| Type | Program | Version | Descriptor |
| SMILES | ACDLabs | 12.01 | CN1CCC=C(C1)c1nsnc1OCCCCCC |
| SMILES | CACTVS | 3.385 | CCCCCCOc1nsnc1C2=CCCN(C)C2 |
| SMILES | OpenEye OEToolkits | 2.0.7 | CCCCCCOc1c(nsn1)C2=CCCN(C2)C |
| Canonical SMILES | CACTVS | 3.385 | CCCCCCOc1nsnc1C2=CCCN(C)C2 |
| Canonical SMILES | OpenEye OEToolkits | 2.0.7 | CCCCCCOc1c(nsn1)C2=CCCN(C2)C |
| InChI | InChI | 1.06 | InChI=1S/C14H23N3OS/c1-3-4-5-6-10-18-14-13(15-19-16-14)12-8-7-9-17(2)11-12/h8H,3-7,9-11H2,1-2H3 |
| InChIKey | InChI | 1.06 | JOLJIIDDOBNFHW-UHFFFAOYSA-N |
Drug Info: DrugBank
DrugBank data are sourced from datasets licensed under a Creative Common's Attribution-NonCommercial 4.0 International License
| DrugBank ID | DB15357 |
|---|---|
| Name | Xanomeline |
| Description | Xanomeline is under investigation in clinical trial NCT02831231 (Pilot Study Comparing Effects of Xanomeline Alone to Xanomeline Plus Trospium). |
| Synonyms | Xanomeline |
| Categories |
|
| CAS number | 131986-45-3 |
Related Resource References
| Resource Name | Reference |
|---|---|
| Pharos | CHEMBL21536 |
| PubChem | 60809 |
| ChEMBL | CHEMBL21536 |
| ChEBI | CHEBI:10056 |














