PN0
Prinomastat
| Created: | 2011-02-10 |
| Last modified: | 2021-03-13 |
Find Related PDB Entry |
|---|
Find related ligands:Help |
|---|
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 49 |
| Chiral Atom Count | 1 |
| Bond Count | 51 |
| Aromatic Bond Count | 12 |
Chemical Component Summary | |
|---|---|
| Name | Prinomastat |
| Synonyms | (3S)-N-hydroxy-2,2-dimethyl-4-{[4-(pyridin-4-yloxy)phenyl]sulfonyl}thiomorpholine-3-carboxamide |
| Systematic Name (OpenEye OEToolkits) | (3S)-N-hydroxy-2,2-dimethyl-4-(4-pyridin-4-yloxyphenyl)sulfonyl-thiomorpholine-3-carboxamide |
| Formula | C18 H21 N3 O5 S2 |
| Molecular Weight | 423.506 |
| Type | NON-POLYMER |
Chemical Descriptors | |||
|---|---|---|---|
| Type | Program | Version | Descriptor |
| SMILES | ACDLabs | 12.01 | O=S(=O)(N1C(C(=O)NO)C(SCC1)(C)C)c3ccc(Oc2ccncc2)cc3 |
| SMILES | CACTVS | 3.370 | CC1(C)SCCN([CH]1C(=O)NO)[S](=O)(=O)c2ccc(Oc3ccncc3)cc2 |
| SMILES | OpenEye OEToolkits | 1.7.0 | CC1(C(N(CCS1)S(=O)(=O)c2ccc(cc2)Oc3ccncc3)C(=O)NO)C |
| Canonical SMILES | CACTVS | 3.370 | CC1(C)SCCN([C@H]1C(=O)NO)[S](=O)(=O)c2ccc(Oc3ccncc3)cc2 |
| Canonical SMILES | OpenEye OEToolkits | 1.7.0 | CC1([C@@H](N(CCS1)S(=O)(=O)c2ccc(cc2)Oc3ccncc3)C(=O)NO)C |
| InChI | InChI | 1.03 | InChI=1S/C18H21N3O5S2/c1-18(2)16(17(22)20-23)21(11-12-27-18)28(24,25)15-5-3-13(4-6-15)26-14-7-9-19-10-8-14/h3-10,16,23H,11-12H2,1-2H3,(H,20,22)/t16-/m0/s1 |
| InChIKey | InChI | 1.03 | YKPYIPVDTNNYCN-INIZCTEOSA-N |
Drug Info: DrugBank
DrugBank data are sourced from datasets licensed under a Creative Common's Attribution-NonCommercial 4.0 International License
| DrugBank ID | DB05100 |
|---|---|
| Name | Prinomastat |
| Groups | investigational |
| Description | Prinomastat is a synthetic hydroxamic acid derivative with potential antineoplastic activity. Prinomastat inhibits matrix metalloproteinases (MMPs) (specifically, MMP-2, 9, 13, and 14), thereby inducing extracellular matrix degradation, and inhibiting angiogenesis, tumor growth and invasion, and metastasis. As a lipophilic agent, prinomastat crosses the blood-brain barrier. |
| Synonyms |
|
| Indication | Investigated for use/treatment in brain cancer, lung cancer, and prostate cancer. |
| Categories |
|
| CAS number | 192329-42-3 |
Drug Targets
DrugBank data are sourced from datasets licensed under a Creative Common's Attribution-NonCommercial 4.0 International License
| Name | Target Sequence | Pharmacological Action | Actions |
|---|---|---|---|
| Matrilysin | MRLTVLCAVCLLPGSLALPLPQEAGGMSELQWEQAQDYLKRFYLYDSETK... | unknown | inhibitor |
| Interstitial collagenase | MHSFPPLLLLLFWGVVSHSFPATLETQEQDVDLVQKYLEKYYNLKNDGRQ... | unknown | inhibitor |
| 72 kDa type IV collagenase | MEALMARGALTGPLRALCLLGCLLSHAAAAPSPIIKFPGDVAPKTDKELA... | unknown | inhibitor |
Drug Info/Drug Targets: DrugBank 3.0: a comprehensive resource for 'omics' research on drugs. Knox C, Law V, Jewison
T, Liu P, Ly S, Frolkis A, Pon A, Banco K, Mak C, Neveu V, Djoumbou Y, Eisner R, Guo AC, Wishart DS.
Nucleic Acids Res. 2011 Jan; 39 (Database issue):D1035-41. | PMID:21059682
Related Resource References
| Resource Name | Reference |
|---|---|
| Pharos | CHEMBL75094 |
| PubChem | 466151 |
| ChEMBL | CHEMBL75094 |
| ChEBI | CHEBI:138885 |














