Chemical Component Summary | |
|---|---|
| Name | Pregnanolone |
| Synonyms | (3alpha,5beta)-3-Hydroxypregnan-20-one |
| Identifiers | 1-[(3~{R},5~{R},8~{R},9~{S},10~{S},13~{S},14~{S},17~{S})-10,13-dimethyl-3-oxidanyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1~{H}-cyclopenta[a]phenanthren-17-yl]ethanone |
| Formula | C21 H34 O2 |
| Molecular Weight | 318.493 |
| Type | NON-POLYMER |
| Isomeric SMILES | CC(=O)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC[C@H]4[C@@]3(CC[C@H](C4)O)C)C |
| InChI | InChI=1S/C21H34O2/c1-13(22)17-6-7-18-16-5-4-14-12-15(23)8-10-20(14,2)19(16)9-11-21(17,18)3/h14-19,23H,4-12H2,1-3H3/t14-,15-,16+,17-,18+,19+,20+,21-/m1/s1 |
| InChIKey | AURFZBICLPNKBZ-YZRLXODZSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 57 |
| Chiral Atom Count | 8 |
| Bond Count | 60 |
| Aromatic Bond Count | 0 |
Drug Info: DrugBank
| DrugBank ID | DB12308 |
|---|---|
| Name | Eltanolone |
| Groups | investigational |
| Description | Eltanolone is under investigation in clinical trial NCT02603926 (Treatment of Fragile-X Associated Tremor/Ataxia Syndrome (FXTAS) With Allopregnanolone). |
| Synonyms |
|
| Categories |
|
| CAS number | 128-20-1 |
Related Resource References
| Resource Name | Reference |
|---|---|
| PubChem | 31402 |
| ChEMBL | CHEMBL210952 |
| ChEBI | CHEBI:1712 |
