M51
{(2S,4S)-4-[4-(3-methyl-1-phenyl-1H-pyrazol-5-yl)piperazin-1-yl]pyrrolidin-2-yl}(1,3-thiazolidin-3-yl)methanone
Find entries where: M51
is present as a standalone ligand in 1 entries
Chemical Component Summary | |
|---|---|
| Name | {(2S,4S)-4-[4-(3-methyl-1-phenyl-1H-pyrazol-5-yl)piperazin-1-yl]pyrrolidin-2-yl}(1,3-thiazolidin-3-yl)methanone |
| Synonyms | Teneligliptin |
| Identifiers | [(2S,4S)-4-[4-(5-methyl-2-phenyl-pyrazol-3-yl)piperazin-1-yl]pyrrolidin-2-yl]-(1,3-thiazolidin-3-yl)methanone |
| Formula | C22 H30 N6 O S |
| Molecular Weight | 426.578 |
| Type | NON-POLYMER |
| Isomeric SMILES | Cc1cc(n(n1)c2ccccc2)N3CCN(CC3)[C@H]4C[C@H](NC4)C(=O)N5CCSC5 |
| InChI | InChI=1S/C22H30N6OS/c1-17-13-21(28(24-17)18-5-3-2-4-6-18)26-9-7-25(8-10-26)19-14-20(23-15-19)22(29)27-11-12-30-16-27/h2-6,13,19-20,23H,7-12,14-16H2,1H3/t19-,20-/m0/s1 |
| InChIKey | WGRQANOPCQRCME-PMACEKPBSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 60 |
| Chiral Atom Count | 2 |
| Bond Count | 64 |
| Aromatic Bond Count | 11 |
Drug Info: DrugBank
| DrugBank ID | DB11950 |
|---|---|
| Name | Teneligliptin |
| Groups | investigational |
| Description | Teneligliptin has been investigated for the treatment of Type 2 Diabetes Mellitus. |
| Synonyms | Teneligliptin |
| Categories |
|
| ATC-Code | A10BH08 |
| CAS number | 760937-92-6 |
Related Resource References
| Resource Name | Reference |
|---|---|
| Pharos | CHEMBL2147777 |
| PubChem | 11949652 |
| ChEMBL | CHEMBL2147777 |
| ChEBI | CHEBI:136042 |
