GXU
1-(2-methoxyethyl)-2-methyl-3-(pyrazin-2-ylmethyl)benzo[f]benzimidazol-3-ium-4,9-dione
| Created: | 2020-10-08 |
| Last modified: | 2021-04-21 |
Find Related PDB Entry |
|---|
Find related ligands:Help |
|---|
Chemical Details | |
|---|---|
| Formal Charge | 1 |
| Atom Count | 46 |
| Chiral Atom Count | 0 |
| Bond Count | 49 |
| Aromatic Bond Count | 17 |
Chemical Component Summary | |
|---|---|
| Name | 1-(2-methoxyethyl)-2-methyl-3-(pyrazin-2-ylmethyl)benzo[f]benzimidazol-3-ium-4,9-dione |
| Systematic Name (OpenEye OEToolkits) | 1-(2-methoxyethyl)-2-methyl-3-(pyrazin-2-ylmethyl)benzo[f]benzimidazol-3-ium-4,9-dione |
| Formula | C20 H19 N4 O3 |
| Molecular Weight | 363.39 |
| Type | NON-POLYMER |
Chemical Descriptors | |||
|---|---|---|---|
| Type | Program | Version | Descriptor |
| SMILES | CACTVS | 3.385 | COCCn1c(C)[n+](Cc2cnccn2)c3C(=O)c4ccccc4C(=O)c13 |
| SMILES | OpenEye OEToolkits | 2.0.7 | Cc1n(c2c([n+]1Cc3cnccn3)C(=O)c4ccccc4C2=O)CCOC |
| Canonical SMILES | CACTVS | 3.385 | COCCn1c(C)[n+](Cc2cnccn2)c3C(=O)c4ccccc4C(=O)c13 |
| Canonical SMILES | OpenEye OEToolkits | 2.0.7 | Cc1n(c2c([n+]1Cc3cnccn3)C(=O)c4ccccc4C2=O)CCOC |
| InChI | InChI | 1.03 | InChI=1S/C20H19N4O3/c1-13-23(9-10-27-2)17-18(24(13)12-14-11-21-7-8-22-14)20(26)16-6-4-3-5-15(16)19(17)25/h3-8,11H,9-10,12H2,1-2H3/q+1 |
| InChIKey | InChI | 1.03 | OTSOOHRUMBRSHZ-UHFFFAOYSA-N |
Drug Info: DrugBank
DrugBank data are sourced from datasets licensed under a Creative Common's Attribution-NonCommercial 4.0 International License
| DrugBank ID | DB17062 |
|---|---|
| Name | Sepantronium |
| Groups | investigational |
| Description | Sepantronium is a compound that suppresses survivin expression in a dose and time-dependent manner, and causes broad-range apoptosis.[A253167] |
| Synonyms |
|
| Categories |
|
| CAS number | 753440-91-4 |
Related Resource References
| Resource Name | Reference |
|---|---|
| PubChem | 10126189 |
| ChEMBL | CHEMBL2110734 |
| ChEBI | CHEBI:94552 |














