B81
(3alpha,8alpha,17beta)-androst-5-ene-3,17-diol
| Created: | 2009-07-29 |
| Last modified: | 2021-03-01 |
Find Related PDB Entry |
|---|
Find related ligands:Help |
|---|
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 51 |
| Chiral Atom Count | 7 |
| Bond Count | 54 |
| Aromatic Bond Count | 0 |
Chemical Component Summary | |
|---|---|
| Name | (3alpha,8alpha,17beta)-androst-5-ene-3,17-diol |
| Synonyms | 5-Androstenediol |
| Systematic Name (OpenEye OEToolkits) | (3S,8R,9S,10R,13S,14S,17S)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,17-diol |
| Formula | C19 H30 O2 |
| Molecular Weight | 290.44 |
| Type | NON-POLYMER |
Chemical Descriptors | |||
|---|---|---|---|
| Type | Program | Version | Descriptor |
| SMILES | ACDLabs | 11.02 | OC4CCC1(C(=CCC2C1CCC3(C2CCC3O)C)C4)C |
| SMILES | CACTVS | 3.352 | C[C]12CC[CH]3[CH](CC=C4C[CH](O)CC[C]34C)[CH]1CC[CH]2O |
| SMILES | OpenEye OEToolkits | 1.7.0 | CC12CCC3C(C1CCC2O)CC=C4C3(CCC(C4)O)C |
| Canonical SMILES | CACTVS | 3.352 | C[C@]12CC[C@H]3[C@@H](CC=C4C[C@@H](O)CC[C@]34C)[C@@H]1CC[C@@H]2O |
| Canonical SMILES | OpenEye OEToolkits | 1.7.0 | C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2O)CC=C4[C@@]3(CC[C@@H](C4)O)C |
| InChI | InChI | 1.03 | InChI=1S/C19H30O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h3,13-17,20-21H,4-11H2,1-2H3/t13-,14-,15-,16-,17-,18-,19-/m0/s1 |
| InChIKey | InChI | 1.03 | QADHLRWLCPCEKT-LOVVWNRFSA-N |
Drug Info: DrugBank
DrugBank data are sourced from datasets licensed under a Creative Common's Attribution-NonCommercial 4.0 International License
| DrugBank ID | DB01524 |
|---|---|
| Name | Androstenediol |
| Description | Androstenediol is an intermediate in [testosterone] biosynthesis, found in the testis or the adrenal glands. Androstenediol, derived from dehydroepiandrosterone by the reduction of the 17-keto group (17-hydroxysteroid dehydrogenases), is converted to testosterone by the oxidation of the 3-beta hydroxyl group to a 3-keto group (3-hydroxysteroid dehydrogenases). |
| Synonyms |
|
| Categories |
|
| CAS number | 521-17-5 |
Related Resource References
| Resource Name | Reference |
|---|---|
| Pharos | CHEMBL440283 |
| PubChem | 10634 |
| ChEMBL | CHEMBL440283 |
| ChEBI | CHEBI:2710 |














