A1E6C
Zoniporide
| Created: | 2026-03-03 |
| Last modified: | 2026-08-05 |
Find Related PDB Entry |
|---|
Find related ligands:Help |
|---|
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 40 |
| Chiral Atom Count | 0 |
| Bond Count | 43 |
| Aromatic Bond Count | 16 |
Chemical Component Summary | |
|---|---|
| Name | Zoniporide |
| Systematic Name (OpenEye OEToolkits) | ~{N}-carbamimidoyl-5-cyclopropyl-1-quinolin-5-yl-pyrazole-4-carboxamide |
| Formula | C17 H16 N6 O |
| Molecular Weight | 320.349 |
| Type | NON-POLYMER |
Chemical Descriptors | |||
|---|---|---|---|
| Type | Program | Version | Descriptor |
| SMILES | CACTVS | 3.385 | NC(=N)NC(=O)c1cnn(c2cccc3ncccc23)c1C4CC4 |
| SMILES | OpenEye OEToolkits | 2.0.7 | c1cc2c(cccn2)c(c1)n3c(c(cn3)C(=O)NC(=N)N)C4CC4 |
| Canonical SMILES | CACTVS | 3.385 | NC(=N)NC(=O)c1cnn(c2cccc3ncccc23)c1C4CC4 |
| Canonical SMILES | OpenEye OEToolkits | 2.0.7 | [H]/N=C(\N)/NC(=O)c1cnn(c1C2CC2)c3cccc4c3cccn4 |
| InChI | InChI | 1.06 | InChI=1S/C17H16N6O/c18-17(19)22-16(24)12-9-21-23(15(12)10-6-7-10)14-5-1-4-13-11(14)3-2-8-20-13/h1-5,8-10H,6-7H2,(H4,18,19,22,24) |
| InChIKey | InChI | 1.06 | GDXBRVCQGGKXJY-UHFFFAOYSA-N |
Drug Info: DrugBank
DrugBank data are sourced from datasets licensed under a Creative Common's Attribution-NonCommercial 4.0 International License
| DrugBank ID | DB20312 |
|---|---|
| Name | Zoniporide |
| Groups | experimental |
| Description | Zoniporide is a small molecule drug. The usage of the INN stem '-poride' in the name indicates that Zoniporide is a Na+/H+ antiport inhibitor. Zoniporide has a monoisotopic molecular weight of 320.14 Da. |
| Synonyms | Zoniporide |
| Categories | Amidines |
| CAS number | 241800-98-6 |
Related Resource References
| Resource Name | Reference |
|---|---|
| Pharos | CHEMBL355862 |
| PubChem | 135564783, 6433110 |
| ChEMBL | CHEMBL355862 |