A1E1F
Sulfamethazine
| Created: | 2025-12-01 |
| Last modified: | 2026-09-30 |
Find Related PDB Entry |
|---|
Find related ligands:Help |
|---|
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 33 |
| Chiral Atom Count | 0 |
| Bond Count | 34 |
| Aromatic Bond Count | 12 |
Chemical Component Summary | |
|---|---|
| Name | Sulfamethazine |
| Synonyms | 4-azanyl-~{N}-(4,6-dimethylpyrimidin-2-yl)benzenesulfonamide |
| Systematic Name (OpenEye OEToolkits) | 4-azanyl-~{N}-(4,6-dimethylpyrimidin-2-yl)benzenesulfonamide |
| Formula | C12 H14 N4 O2 S |
| Molecular Weight | 278.33 |
| Type | NON-POLYMER |
Chemical Descriptors | |||
|---|---|---|---|
| Type | Program | Version | Descriptor |
| SMILES | CACTVS | 3.385 | Cc1cc(C)nc(N[S](=O)(=O)c2ccc(N)cc2)n1 |
| SMILES | OpenEye OEToolkits | 2.0.7 | Cc1cc(nc(n1)NS(=O)(=O)c2ccc(cc2)N)C |
| Canonical SMILES | CACTVS | 3.385 | Cc1cc(C)nc(N[S](=O)(=O)c2ccc(N)cc2)n1 |
| Canonical SMILES | OpenEye OEToolkits | 2.0.7 | Cc1cc(nc(n1)NS(=O)(=O)c2ccc(cc2)N)C |
| InChI | InChI | 1.06 | InChI=1S/C12H14N4O2S/c1-8-7-9(2)15-12(14-8)16-19(17,18)11-5-3-10(13)4-6-11/h3-7H,13H2,1-2H3,(H,14,15,16) |
| InChIKey | InChI | 1.06 | ASWVTGNCAZCNNR-UHFFFAOYSA-N |
Drug Info: DrugBank
DrugBank data are sourced from datasets licensed under a Creative Common's Attribution-NonCommercial 4.0 International License
| DrugBank ID | DB01582 |
|---|---|
| Name | Sulfamethazine |
| Groups |
|
| Description | A sulfanilamide anti-infective agent. It has a spectrum of antimicrobial action similar to other sulfonamides. |
| Synonyms |
|
| Brand Names |
|
| Indication | For the treatment bacterial infections causing bronchitis, prostatitis and urinary tract infections. |
| Categories |
|
| ATC-Code |
|
| CAS number | 57-68-1 |
Drug Targets
DrugBank data are sourced from datasets licensed under a Creative Common's Attribution-NonCommercial 4.0 International License
| Name | Target Sequence | Pharmacological Action | Actions |
|---|---|---|---|
| Dihydropteroate synthase | MKLFAQGTSLDLSHPHVMGILNVTPDSFSDGGTHNSLIDAVKHANLMINA... | unknown | inhibitor |
| Arylamine N-acetyltransferase | MALDLTAYFDRINYRGATDPTLDVLQDLVTVHSRTIPFENLDPLLGVPVD... | unknown | substrate |
| Albumin | MKWVTFISLLFLFSSAYSRGVFRRDAHKSEVAHRFKDLGEENFKALVLIA... | unknown |
Drug Info/Drug Targets: DrugBank 3.0: a comprehensive resource for 'omics' research on drugs. Knox C, Law V, Jewison
T, Liu P, Ly S, Frolkis A, Pon A, Banco K, Mak C, Neveu V, Djoumbou Y, Eisner R, Guo AC, Wishart DS.
Nucleic Acids Res. 2011 Jan; 39 (Database issue):D1035-41. | PMID:21059682