A1D8Y
5-[4-[[6-(4-methylsulfonylphenyl)pyridin-3-yl]oxymethyl]piperidin-1-yl]-3-propan-2-yl-1,2,4-oxadiazole
Find entries where: A1D8Y
is present as a standalone ligand in 1 entries
Chemical Component Summary | |
|---|---|
| Name | 5-[4-[[6-(4-methylsulfonylphenyl)pyridin-3-yl]oxymethyl]piperidin-1-yl]-3-propan-2-yl-1,2,4-oxadiazole |
| Synonyms | GSK1292263 |
| Identifiers | 5-[4-[[6-(4-methylsulfonylphenyl)pyridin-3-yl]oxymethyl]piperidin-1-yl]-3-propan-2-yl-1,2,4-oxadiazole |
| Formula | C23 H28 N4 O4 S |
| Molecular Weight | 456.558 |
| Type | NON-POLYMER |
| Isomeric SMILES | CC(C)c1nc(on1)N2CCC(CC2)COc3ccc(nc3)c4ccc(cc4)S(=O)(=O)C |
| InChI | InChI=1S/C23H28N4O4S/c1-16(2)22-25-23(31-26-22)27-12-10-17(11-13-27)15-30-19-6-9-21(24-14-19)18-4-7-20(8-5-18)32(3,28)29/h4-9,14,16-17H,10-13,15H2,1-3H3 |
| InChIKey | AYJRTVVIBJSSKN-UHFFFAOYSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 60 |
| Chiral Atom Count | 0 |
| Bond Count | 63 |
| Aromatic Bond Count | 17 |
Drug Info: DrugBank
| DrugBank ID | DB12627 |
|---|---|
| Name | GSK-1292263 |
| Groups | investigational |
| Description | GSK1292263 has been investigated for the treatment of DIABETES MELLITUS, TYPE 2. |
| Synonyms | GSK-1292263 |
| CAS number | 1032823-75-8 |
Related Resource References
| Resource Name | Reference |
|---|---|
| Pharos | CHEMBL3187503 |
| PubChem | 24996872 |
| ChEMBL | CHEMBL3187503 |
