Chemical Component Summary | |
|---|---|
| Name | verinurad |
| Synonyms | 2-{[(3P)-3-(4-cyanonaphthalen-1-yl)pyridin-4-yl]sulfanyl}-2-methylpropanoic acid |
| Identifiers | 2-[3-(4-cyanonaphthalen-1-yl)pyridin-4-yl]sulfanyl-2-methyl-propanoic acid |
| Formula | C20 H16 N2 O2 S |
| Molecular Weight | 348.418 |
| Type | NON-POLYMER |
| Isomeric SMILES | CC(C)(C(=O)O)Sc1ccncc1c2ccc(c3c2cccc3)C#N |
| InChI | InChI=1S/C20H16N2O2S/c1-20(2,19(23)24)25-18-9-10-22-12-17(18)16-8-7-13(11-21)14-5-3-4-6-15(14)16/h3-10,12H,1-2H3,(H,23,24) |
| InChIKey | YYBOLPLTQDKXPM-UHFFFAOYSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 41 |
| Chiral Atom Count | 0 |
| Bond Count | 43 |
| Aromatic Bond Count | 17 |
Drug Info: DrugBank
| DrugBank ID | DB11873 |
|---|---|
| Name | Verinurad |
| Groups | investigational |
| Description | Verinurad has been used in trials studying the basic science and treatment of Gout, Gout and Hyperuricemia, and Gout and Asymptomatic Hyperuricemia. |
| Synonyms | Verinurad |
| Categories |
|
| CAS number | 1352792-74-5 |
Related Resource References
| Resource Name | Reference |
|---|---|
| Pharos | CHEMBL3707347 |
| PubChem | 54767229 |
| ChEMBL | CHEMBL3707347 |
