9IR
(4R)-1-methyl-4-(prop-1-en-2-yl)cyclohex-1-ene
| Created: | 2021-10-18 |
| Last modified: | 2022-11-23 |
Find Related PDB Entry |
|---|
Find related ligands:Help |
|---|
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 26 |
| Chiral Atom Count | 1 |
| Bond Count | 26 |
| Aromatic Bond Count | 0 |
Chemical Component Summary | |
|---|---|
| Name | (4R)-1-methyl-4-(prop-1-en-2-yl)cyclohex-1-ene |
| Synonyms | R-(+)-limonene |
| Systematic Name (OpenEye OEToolkits) | (4~{R})-1-methyl-4-prop-1-en-2-yl-cyclohexene |
| Formula | C10 H16 |
| Molecular Weight | 136.234 |
| Type | NON-POLYMER |
Chemical Descriptors | |||
|---|---|---|---|
| Type | Program | Version | Descriptor |
| SMILES | ACDLabs | 12.01 | CC1=CCC(CC1)C(C)=C |
| SMILES | CACTVS | 3.385 | CC(=C)[CH]1CCC(=CC1)C |
| SMILES | OpenEye OEToolkits | 2.0.7 | CC1=CCC(CC1)C(=C)C |
| Canonical SMILES | CACTVS | 3.385 | CC(=C)[C@@H]1CCC(=CC1)C |
| Canonical SMILES | OpenEye OEToolkits | 2.0.7 | CC1=CC[C@@H](CC1)C(=C)C |
| InChI | InChI | 1.03 | InChI=1S/C10H16/c1-8(2)10-6-4-9(3)5-7-10/h4,10H,1,5-7H2,2-3H3/t10-/m0/s1 |
| InChIKey | InChI | 1.03 | XMGQYMWWDOXHJM-JTQLQIEISA-N |
Drug Info: DrugBank
DrugBank data are sourced from datasets licensed under a Creative Common's Attribution-NonCommercial 4.0 International License
| DrugBank ID | DB08921 |
|---|---|
| Name | (4R)-limonene |
| Groups | investigational |
| Description | Limonene is common in cosmetic products. As the main odor constituent of citrus (plant family Rutaceae), D-limonene is used in food manufacturing and some medicines, e.g. as a flavoring to mask the bitter taste of alkaloids, and as a fragrant in perfumery. |
| Synonyms |
|
| Brand Names |
|
| Categories |
|
| CAS number | 5989-27-5 |
Related Resource References
| Resource Name | Reference |
|---|---|
| PubChem | 440917 |
| ChEMBL | CHEMBL449062 |
| ChEBI | CHEBI:15382 |