88U
N-(4-methoxyphenyl)-N,2-dimethyl-quinazolin-4-amine
| Created: | 2017-05-18 |
| Last modified: | 2018-04-18 |
Find Related PDB Entry |
|---|
Find related ligands: |
|---|
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 38 |
| Chiral Atom Count | 0 |
| Bond Count | 40 |
| Aromatic Bond Count | 17 |
Chemical Component Summary | |
|---|---|
| Name | N-(4-methoxyphenyl)-N,2-dimethyl-quinazolin-4-amine |
| Systematic Name (OpenEye OEToolkits) | ~{N}-(4-methoxyphenyl)-~{N},2-dimethyl-quinazolin-4-amine |
| Formula | C17 H17 N3 O |
| Molecular Weight | 279.336 |
| Type | NON-POLYMER |
Chemical Descriptors | |||
|---|---|---|---|
| Type | Program | Version | Descriptor |
| SMILES | CACTVS | 3.385 | COc1ccc(cc1)N(C)c2nc(C)nc3ccccc23 |
| SMILES | OpenEye OEToolkits | 2.0.6 | Cc1nc2ccccc2c(n1)N(C)c3ccc(cc3)OC |
| Canonical SMILES | CACTVS | 3.385 | COc1ccc(cc1)N(C)c2nc(C)nc3ccccc23 |
| Canonical SMILES | OpenEye OEToolkits | 2.0.6 | Cc1nc2ccccc2c(n1)N(C)c3ccc(cc3)OC |
| InChI | InChI | 1.03 | InChI=1S/C17H17N3O/c1-12-18-16-7-5-4-6-15(16)17(19-12)20(2)13-8-10-14(21-3)11-9-13/h4-11H,1-3H3 |
| InChIKey | InChI | 1.03 | SNHCRNMVYDHVDT-UHFFFAOYSA-N |
Drug Info: DrugBank
DrugBank data are sourced from datasets licensed under a Creative Common's Attribution-NonCommercial 4.0 International License
| DrugBank ID | DB05585 |
|---|---|
| Name | Verubulin |
| Groups | investigational |
| Description | Antineoplastic; a small-molecule inhibitor of microtubule formation that is not a substrate for multidrug resistance pumps. |
| Synonyms |
|
| Indication | Investigated for use/treatment in brain cancer, lung cancer, melanoma, and solid tumors. |
| Categories | Heterocyclic Compounds, Fused-Ring |
| CAS number | 827031-83-4 |
Related Resource References
| Resource Name | Reference |
|---|---|
| Pharos | CHEMBL492399 |
| PubChem | 11414799 |
| ChEMBL | CHEMBL492399 |
