Chemical Component Summary | |
|---|---|
| Name | PF-3758309 |
| Identifiers | ~{N}-[(1~{S})-2-(dimethylamino)-1-phenyl-ethyl]-6,6-dimethyl-3-[(2-methylthieno[3,2-d]pyrimidin-4-yl)amino]-1,4-dihydropyrrolo[3,4-c]pyrazole-5-carboxamide |
| Formula | C25 H30 N8 O S |
| Molecular Weight | 490.624 |
| Type | NON-POLYMER |
| Isomeric SMILES | Cc1nc2ccsc2c(n1)Nc3c4c([nH]n3)C(N(C4)C(=O)N[C@H](CN(C)C)c5ccccc5)(C)C |
| InChI | InChI=1S/C25H30N8OS/c1-15-26-18-11-12-35-20(18)23(27-15)29-22-17-13-33(25(2,3)21(17)30-31-22)24(34)28-19(14-32(4)5)16-9-7-6-8-10-16/h6-12,19H,13-14H2,1-5H3,(H,28,34)(H2,26,27,29,30,31)/t19-/m1/s1 |
| InChIKey | AYCPARAPKDAOEN-LJQANCHMSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 65 |
| Chiral Atom Count | 1 |
| Bond Count | 69 |
| Aromatic Bond Count | 21 |
Drug Info: DrugBank
| DrugBank ID | DB11775 |
|---|---|
| Name | PF-03758309 |
| Groups | investigational |
| Description | PF-03758309 has been used in trials studying the treatment of Advanced Solid Tumors. |
| Synonyms |
|
| Categories | p21-Activated Kinases, antagonists & inhibitors |
| CAS number | 898044-15-0 |
Related Resource References
| Resource Name | Reference |
|---|---|
| Pharos | CHEMBL3128043 |
| PubChem | 25227462 |
| ChEMBL | CHEMBL3128043 |
| ChEBI | CHEBI:93751 |
