7I4
1-[[2-fluoranyl-4-[5-[4-(2-methylpropyl)phenyl]-1,2,4-oxadiazol-3-yl]phenyl]methyl]azetidine-3-carboxylic acid
| Created: | 2021-10-01 |
| Last modified: | 2022-09-28 |
Find Related PDB Entry |
|---|
Find related ligands: |
|---|
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 54 |
| Chiral Atom Count | 0 |
| Bond Count | 57 |
| Aromatic Bond Count | 17 |
Chemical Component Summary | |
|---|---|
| Name | 1-[[2-fluoranyl-4-[5-[4-(2-methylpropyl)phenyl]-1,2,4-oxadiazol-3-yl]phenyl]methyl]azetidine-3-carboxylic acid |
| Systematic Name (OpenEye OEToolkits) | 1-[[2-fluoranyl-4-[5-[4-(2-methylpropyl)phenyl]-1,2,4-oxadiazol-3-yl]phenyl]methyl]azetidine-3-carboxylic acid |
| Formula | C23 H24 F N3 O3 |
| Molecular Weight | 409.453 |
| Type | NON-POLYMER |
Chemical Descriptors | |||
|---|---|---|---|
| Type | Program | Version | Descriptor |
| SMILES | CACTVS | 3.385 | CC(C)Cc1ccc(cc1)c2onc(n2)c3ccc(CN4CC(C4)C(O)=O)c(F)c3 |
| SMILES | OpenEye OEToolkits | 2.0.7 | CC(C)Cc1ccc(cc1)c2nc(no2)c3ccc(c(c3)F)CN4CC(C4)C(=O)O |
| Canonical SMILES | CACTVS | 3.385 | CC(C)Cc1ccc(cc1)c2onc(n2)c3ccc(CN4CC(C4)C(O)=O)c(F)c3 |
| Canonical SMILES | OpenEye OEToolkits | 2.0.7 | CC(C)Cc1ccc(cc1)c2nc(no2)c3ccc(c(c3)F)CN4CC(C4)C(=O)O |
| InChI | InChI | 1.06 | InChI=1S/C23H24FN3O3/c1-14(2)9-15-3-5-16(6-4-15)22-25-21(26-30-22)17-7-8-18(20(24)10-17)11-27-12-19(13-27)23(28)29/h3-8,10,14,19H,9,11-13H2,1-2H3,(H,28,29) |
| InChIKey | InChI | 1.06 | YBIFMTGYWXNIRZ-UHFFFAOYSA-N |
Drug Info: DrugBank
DrugBank data are sourced from datasets licensed under a Creative Common's Attribution-NonCommercial 4.0 International License
| DrugBank ID | DB21572 |
|---|---|
| Name | Icanbelimod |
| Groups | experimental |
| Description | Icanbelimod is a small molecule drug. The usage of the INN stem '-imod' in the name indicates that Icanbelimod is a immunomodulator, both stimulant/suppressive and stimulant. Icanbelimod has a monoisotopic molecular weight of 409.18 Da. |
| Synonyms |
|
| CAS number | 1514888-56-2 |
Related Resource References
| Resource Name | Reference |
|---|---|
| PubChem | 117972004 |
| ChEMBL | CHEMBL4097139 |














