0M4: N-(4-chloro-3-fluorophenyl)-N'-[(3aS,6aS)-hexahydrocyclopenta[c]pyrrol-3a(1H)-ylmethyl]ethanediamide
0M4 is a Ligand Of Interest in 4DVW designated by the RCSB
| Best-fitted instance in this entry | |
| Other instances in this entry |
| Identifier | Ranking for goodness of fit | Ranking for geometry | Real space R factor | Real space correlation coefficient | RMSZ-bond-length | RMSZ-bond-angle | Outliers of bond length | Outliers of bond angle | Atomic clashes | Stereochemical errors | Model completeness | Average occupancy |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| 4DVW_0M4_A_512 | 74% | 42% | 0.077 | 0.947 | 1.09 | 1.09 | 2 | 2 | 3 | 0 | 100% | 1 |
| 4DVW_0M4_B_512 | 52% | 42% | 0.11 | 0.903 | 1.09 | 1.06 | 2 | 2 | 2 | 0 | 100% | 1 |














