0LM: N-(4-chloro-3-fluorophenyl)-N'-(1,2,2,6,6-pentamethylpiperidin-4-yl)ethanediamide
0LM is a Ligand Of Interest in 4DKO designated by the RCSB
| Best-fitted instance in this entry | |
| Other instances in this entry |
| Identifier | Ranking for goodness of fit | Ranking for geometry | Real space R factor | Real space correlation coefficient | RMSZ-bond-length | RMSZ-bond-angle | Outliers of bond length | Outliers of bond angle | Atomic clashes | Stereochemical errors | Model completeness | Average occupancy |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| 4DKO_0LM_A_513 | 3% | 3% | 0.251 | 0.757 | 1.9 | 4.03 | 6 | 6 | 1 | 0 | 100% | 1 |
| 4DKO_0LM_C_513 | 3% | 3% | 0.261 | 0.76 | 1.89 | 4.2 | 6 | 8 | 2 | 0 | 100% | 1 |
