W97
6-ethynyl-1-(pentan-3-yl)-1H-imidazo[4,5-b]pyrazin-2-ol
Find entries where: W97
is present as a standalone ligand in 1 entries
Chemical Component Summary | |
|---|---|
| Name | 6-ethynyl-1-(pentan-3-yl)-1H-imidazo[4,5-b]pyrazin-2-ol |
| Identifiers | 5-ethynyl-3-pentan-3-yl-imidazo[4,5-b]pyrazin-2-ol |
| Formula | C12 H14 N4 O |
| Molecular Weight | 230.266 |
| Type | NON-POLYMER |
| Isomeric SMILES | CCC(CC)n1c2c(ncc(n2)C#C)nc1O |
| InChI | InChI=1S/C12H14N4O/c1-4-8-7-13-10-11(14-8)16(12(17)15-10)9(5-2)6-3/h1,7,9H,5-6H2,2-3H3,(H,13,15,17) |
| InChIKey | RSQGZEAXODVTOL-UHFFFAOYSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 31 |
| Chiral Atom Count | 0 |
| Bond Count | 32 |
| Aromatic Bond Count | 10 |
Drug Info: DrugBank
| DrugBank ID | DB12209 |
|---|---|
| Name | Tirasemtiv |
| Groups | investigational |
| Description | Tirasemtiv has been used in trials studying the treatment of Myasthenia Gravis, Intermittent Claudication, and Amyotrophic Lateral Sclerosis. |
| Synonyms | Tirasemtiv |
| CAS number | 1005491-05-3 |
Related Resource References
| Resource Name | Reference |
|---|---|
| PubChem | 23729157 |
| ChEMBL | CHEMBL3039529 |
