2N5
2-(4-fluorophenyl)-N-methyl-6-[(methylsulfonyl)amino]-5-(propan-2-yloxy)-1-benzofuran-3-carboxamide
Find entries where: 2N5
is present as a standalone ligand in 2 entries
Chemical Component Summary | |
|---|---|
| Name | 2-(4-fluorophenyl)-N-methyl-6-[(methylsulfonyl)amino]-5-(propan-2-yloxy)-1-benzofuran-3-carboxamide |
| Identifiers | 2-(4-fluorophenyl)-N-methyl-6-(methylsulfonylamino)-5-propan-2-yloxy-1-benzofuran-3-carboxamide |
| Formula | C20 H21 F N2 O5 S |
| Molecular Weight | 420.455 |
| Type | NON-POLYMER |
| Isomeric SMILES | CC(C)Oc1cc2c(cc1NS(=O)(=O)C)oc(c2C(=O)NC)c3ccc(cc3)F |
| InChI | InChI=1S/C20H21FN2O5S/c1-11(2)27-17-9-14-16(10-15(17)23-29(4,25)26)28-19(18(14)20(24)22-3)12-5-7-13(21)8-6-12/h5-11,23H,1-4H3,(H,22,24) |
| InChIKey | VBRUONUESYTIDA-UHFFFAOYSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 50 |
| Chiral Atom Count | 0 |
| Bond Count | 52 |
| Aromatic Bond Count | 16 |
Drug Info: DrugBank
| DrugBank ID | DB05884 |
|---|---|
| Name | HCV-086 |
| Groups | investigational |
| Description | HCV-086 is a small molecule antiviral designed to block an enzyme required for the replication of the hepatitis C virus. |
| Synonyms | HCV-086 |
| Indication | Investigated for use/treatment in hepatitis (viral, C). |
Related Resource References
| Resource Name | Reference |
|---|---|
| PubChem | 10409873 |
