1IB
N-ethyl-3-fluoranyl-3-[3-fluoranyl-4-(pyrrolidin-1-ylmethyl)phenyl]cyclobutane-1-carboxamide
Find entries where: 1IB
is present as a standalone ligand in 1 entries
Chemical Component Summary | |
|---|---|
| Name | N-ethyl-3-fluoranyl-3-[3-fluoranyl-4-(pyrrolidin-1-ylmethyl)phenyl]cyclobutane-1-carboxamide |
| Identifiers | ~{N}-ethyl-3-fluoranyl-3-[3-fluoranyl-4-(pyrrolidin-1-ylmethyl)phenyl]cyclobutane-1-carboxamide |
| Formula | C18 H24 F2 N2 O |
| Molecular Weight | 322.393 |
| Type | NON-POLYMER |
| Isomeric SMILES | CCNC(=O)C1CC(C1)(c2ccc(c(c2)F)CN3CCCC3)F |
| InChI | InChI=1S/C18H24F2N2O/c1-2-21-17(23)14-10-18(20,11-14)15-6-5-13(16(19)9-15)12-22-7-3-4-8-22/h5-6,9,14H,2-4,7-8,10-12H2,1H3,(H,21,23)/t14-,18- |
| InChIKey | SXMBKHYDZOCBMT-PPUGGXLSSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 47 |
| Chiral Atom Count | 0 |
| Bond Count | 49 |
| Aromatic Bond Count | 6 |
Drug Info: DrugBank
| DrugBank ID | DB12201 |
|---|---|
| Name | PF-03654746 |
| Groups | investigational |
| Description | PF-03654746 has been investigated for the treatment of Narcolepsy, Schizophrenia, Tourette's Syndrome, and Excessive Daytime Sleepiness. |
| Synonyms | PF-03654746 |
| Categories |
|
| CAS number | 935840-31-6 |
